| |
|
|
| |
|
| |
|
| >>>BEIJING MOUNTAIN TECHNICAL DEVELOPMENT
CENTER FOR NON—FERROUS METALS established |
| in 1999. The speciality is engaged in platesing
the membrane material and develops |
| production in optics. We have optics plate
expert of membrane material several of |
| Professor, solid technological battle array
has established the good foundation for |
| our development. |
| >>>Under the assistance of the
relevant universities and colleges of R&D institution, |
| we have developed more than 70 kinds and
plate membrane material , And has set up a |
| set of steady production technologies and
formed the relatively strong production |
| capacity of scientific research.. The products
include the metal base, the oxide, |
| plate the membrane material in optics of
the fluoride and other chemical compounds |
| types,Suitable for plating the membrane
in the electron gun and hot evaporation.All |
| products are according to standard production
strictly,some products are sold to |
| Taiwan,Japan,The country and area, such
as U.S.A., Korea S.,etc .. |
|
|
Optical Coating
Materials |
| >>>（1）Cpd.： |
| SiO,Hfo2,ZrO2,TiO2,TiO,Ti2O3,Ti3O5,Ta2O5,Nb2O5,SiO2,Al2O3,MgO,Gd2O3,Sm2O3,Nd2O3, |
| Pr6O11,ZnO,WO3,Bi2O3,Sb2O3,Cr2O3,NiO,CeO2,CuO,Fe2O3,V2O5,BaTiO3,SrTiO3,PrTiO3, |
| Pr(TiO3)2,LaTiO3,YbF3,LrF3,YF3,ErF3,SmF3,DyF3,NdF3,CeF3,MgF2,BaF2,SrF3,CaF2,KF, |
| NaF,Na3AiF6,ZnS,CdS, ZnSe, Sc2O3， |
| >>>（2）Mixed material： |
| ZrO2+TiO51:1,ZrO2+Ta2O5,TiO2+Ta2O5,TiO2+Nb2O5,ZrO2+Y2O3,ZrO2+Al2O54:6,Al2O3+TiO29:1 |
| ,Al2O3+MgO1:1,In2O3+SnO29:195:5,SnO2+Zn2O,SnO2+Pt(0.5-1%)SnO2+Pd(0.5-1%),ZnO+Al2O3 |
| CeF3+ CaF21:1,SnO2+In2O3(ITO) |
| >>>（3）Metal： |
| Aluminium silk, Chromium one, Molybdenum
slice, Tantalum slice, Gold silk, Silver silk |
| Platinum silk,Te, Ge,. Hot to reflect membrane
alloy silver gray,etc.. |
| >>>（4）Target material ： |
| Chromium target, zirconium target, aluminium
target, Hafnium target, nickel target, |
| titanium target, Gold target, Cobalt target,
silicon target, stainless steel target, |
| Oxidizing the silicon target two times,aluminium
oxide target, The aluminium target |
| oftitanium, the chromium target of nickel,
ITO target and other alloy target |
| material. |
|
| |
